ChemNet > CAS > 262607-85-2 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N'-hydroxyethanimidamide
262607-85-2 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N'-hydroxyethanimidamide
| product Name |
2-[4-(1,3-dithiolan-2-yl)phenoxy]-N'-hydroxyethanimidamide |
| CAS No |
262607-85-2 |
| Synonyms |
2-[4-(1,3-Dithiolan-2-Yl)Phenoxy]Acetamidoxime |
| Molecular Formula |
C11H14N2O2S2 |
| Molecular Weight |
270.3711 |
| InChI |
InChI=1/C11H14N2O2S2/c12-10(13-14)7-15-9-3-1-8(2-4-9)11-16-5-6-17-11/h1-4,11,14H,5-7H2,(H2,12,13) |
| Molecular Structure |
![262607-85-2 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N'-hydroxyethanimidamide](https://images-a.chemnet.com/suppliers/chembase/291/29152.gif)
|
| Density |
1.44g/cm3 |
| Melting point |
113℃ |
| Boiling point |
527.2°C at 760 mmHg |
| Refractive index |
1.683 |
| Flash point |
272.6°C |
| Vapour Pressur |
6.09E-12mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
